For research use only. Not for therapeutic Use.
Naminterol (Cat.No:I013557) is a selective β2-adrenergic receptor agonist used as a bronchodilator for the treatment of asthma and chronic obstructive pulmonary disease (COPD). It works by relaxing the smooth muscles in the airways, thereby improving airflow and making breathing easier. Naminterol is typically administered via inhalation and provides long-lasting bronchodilation effects.
| Catalog Number | I013557 |
| CAS Number | 93047-40-6 |
| Molecular Formula | C₁₉H₂₆N₂O₃ |
| Purity | ≥95% |
| Target | Adrenergic Receptor |
| Solubility | DMSO |
| IUPAC Name | 1-[3-amino-5-(hydroxymethyl)phenyl]-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethanol |
| InChI | InChI=1S/C19H26N2O3/c1-13(7-14-3-5-18(24-2)6-4-14)21-11-19(23)16-8-15(12-22)9-17(20)10-16/h3-6,8-10,13,19,21-23H,7,11-12,20H2,1-2H3 |
| InChIKey | NHMIZLSLXVYTTL-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)OC)NCC(C2=CC(=CC(=C2)CO)N)O |
