For research use only. Not for therapeutic Use.
Naphthalen-1-yl 1-naphthoate (Cat.No:L003698) is a crucial compound in organic synthesis. Its structure combines naphthyl and ester functionalities, offering versatile reactivity. This compound is a valuable building block for the synthesis of specialized materials and pharmaceuticals, showcasing its significance in contemporary chemical research. Its unique properties and broad applicability underscore its importance in the development of innovative compounds for various industrial and pharmaceutical purposes.
CAS Number | 94966-17-3 |
Molecular Formula | C21H14O2 |
Purity | ≥95% |
IUPAC Name | naphthalen-1-yl naphthalene-1-carboxylate |
InChI | InChI=1S/C21H14O2/c22-21(19-13-5-9-15-7-1-3-11-17(15)19)23-20-14-6-10-16-8-2-4-12-18(16)20/h1-14H |
InChIKey | JVUYDVZHYDIQDL-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)OC3=CC=CC4=CC=CC=C43 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |