For research use only. Not for therapeutic Use.
Naphthalene-1,4-dicarbaldehyde (Cat.No:L003609) is a pivotal aromatic compound used in organic synthesis and materials science. Its unique structure, characterized by two aldehyde groups on adjacent carbons, lends itself to various reactions, enabling the production of specialized materials and pharmaceutical intermediates. This compound’s versatile reactivity and significance in chemical processes highlight its crucial role in the development of advanced materials.
Catalog Number | L003609 |
CAS Number | 38153-01-4 |
Molecular Formula | C12H8O2 |
Purity | ≥95% |
IUPAC Name | naphthalene-1,4-dicarbaldehyde |
InChI | InChI=1S/C12H8O2/c13-7-9-5-6-10(8-14)12-4-2-1-3-11(9)12/h1-8H |
InChIKey | XUFLAVKRRLBIMV-UHFFFAOYSA-N |
SMILES | CCC(C(=O)OC(C)(C)C)Br |