For research use only. Not for therapeutic Use.
Naphthalene-2-carbonyl fluoride(CAT: L000321) is a significant compound in the field of organic chemistry. This chemical serves as a versatile reagent for the introduction of fluorine atoms into organic molecules. Its primary application is in fluorination reactions, where it is used to modify the properties of various organic compounds. In organic chemistry, it is a valuable tool for the synthesis of fluorinated organic molecules with enhanced stability and reactivity.
CAS Number | 37827-83-1 |
Molecular Formula | C11H7FO |
Purity | ≥95% |
IUPAC Name | naphthalene-2-carbonyl fluoride |
InChI | InChI=1S/C11H7FO/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
InChIKey | YDNZYORUANJTLF-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |