For research use only. Not for therapeutic Use.
Naphthalenylisopropylamine（Cat No.:M127397）, also known as 2-naphthylisopropylamine or 2-NPA, is a chemical compound with potential psychoactive properties. It is structurally related to amphetamines and phenylethylamines and is known to interact with neurotransmitter systems in the brain, particularly dopamine, and serotonin. 2-NPA has been studied for its effects on behavior and cognition and has shown some promise in research related to mood disorders and neurodegenerative diseases.
| CAS Number | 18085-03-5 |
| Molecular Formula | C13H15N |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 1-naphthalen-2-ylpropan-2-amine |
| InChI | InChI=1S/C13H15N/c1-10(14)8-11-6-7-12-4-2-3-5-13(12)9-11/h2-7,9-10H,8,14H2,1H3 |
| InChIKey | UPQSZFKXKRKCGZ-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC2=CC=CC=C2C=C1)N |
