For research use only. Not for therapeutic Use.
Naphthazarin(CAT: M163695) is a natural compound and a derivative of naphthoquinone. Its mode of action involves being a red or orange crystalline solid with various biological activities. Naphthazarin is found in certain plant sources and exhibits potential pharmacological properties, including antibacterial, antifungal, and anti-inflammatory effects. Additionally, it has been studied for its potential antioxidant and anticancer activities. As a result of these properties, researchers are interested in exploring its potential therapeutic applications, particularly in traditional medicine and herbal remedies.
CAS Number | 475-38-7 |
Molecular Formula | C10H6O4 |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | 5,8-dihydroxynaphthalene-1,4-dione |
InChI | InChI=1S/C10H6O4/c11-5-1-2-6(12)10-8(14)4-3-7(13)9(5)10/h1-4,11-12H |
InChIKey | RQNVIKXOOKXAJQ-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C(=O)C=CC(=O)C2=C1O)O |