For research use only. Not for therapeutic Use.
| Catalog Number | R004418 |
| CAS Number | 58331-17-2 |
| Synonyms | 4-Methylsalinomycin;Monteban;Narasin A |
| Molecular Formula | C43H71NaO11 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | sodium;2-[6-[6-[3-(5-ethyl-5-hydroxy-6-methyloxan-2-yl)-15-hydroxy-3,10,12-trimethyl-4,6,8-trioxadispiro[4.1.5^{7} |
| InChI | InChI=1S/C43H72O11.Na/c1-12-30(35(46)27(8)34(45)28(9)36-23(4)21-24(5)37(51-36)31(13-2)39(47)48)38-25(6)22-26(7)42(52-38)18-15-32(44)43(54-42)20-19-40(11,53-43)33-16-17-41(49,14-3)29(10)50-33;/h15,18,23-34,36-38,44-45,49H,12-14,16-17,19-22H2,1-11H3,(H,47,48);/q;+1/p-1 |
| InChIKey | NBRZEFXQRCTYMC-UHFFFAOYSA-M |
| SMILES | CCC(C1C(CC(C(O1)C(C)C(C(C)C(=O)C(CC)C2C(CC(C3(O2)C=CC(C4(O3)CCC(O4)(C)C5CCC(C(O5)C)(CC)O)O)C)C)O)C)C)C(=O)[O-].[Na+] |
| Reference | The isolation and characterization of narasin, a new polyether antibiotic. Berg D.H. & Hamill R.L. J. Antibiot. 1978, 31, 1.</span></p> |
