For research use only. Not for therapeutic Use.
Naringenin chalcone is a flavonoid compound found in citrus fruits. This compound exhibits various pharmacological activities, including antioxidant and anti-inflammatory properties. Research suggests its potential in promoting cardiovascular health and reducing oxidative stress. Naringenin chalcone’s natural occurrence and biological activities make it a subject of interest in nutraceutical and pharmaceutical research for potential health benefits.
| Catalog Number | R072623 |
| CAS Number | 73692-50-9 |
| Molecular Formula | C15H12O5 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
| InChI | InChI=1S/C15H12O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-8,16-17,19-20H/b6-3+ |
| InChIKey | YQHMWTPYORBCMF-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1C=CC(=O)C2=C(C=C(C=C2O)O)O)O |
