For research use only. Not for therapeutic Use.
Naringin（Cat No.:I000160）is a natural flavonoid glycoside primarily found in grapefruits and other citrus fruits, known for its antioxidant, anti-inflammatory, and cholesterol-lowering properties. It exerts beneficial effects by neutralizing free radicals, reducing oxidative stress, and supporting cardiovascular health. Additionally, Naringin has been studied for its potential in managing metabolic disorders, including diabetes and obesity, by enhancing insulin sensitivity and modulating lipid metabolism. Its bitter flavor contributes to the distinct taste of grapefruit, while its broad bioactivity makes Naringin a promising compound in nutraceuticals and functional food development.
| Catalog Number | I000160 |
| CAS Number | 10236-47-2 |
| Synonyms | NSC 5548 |
| Molecular Formula | C27H32O14 |
| Purity | ≥95% |
| Target | P450 |
| Solubility | DMSO:116 mg/mL (199.81 mM); Ethanol: 2 mg/mL (3.44 mM); Water: <1 mg/mL (<1 mM) |
| Storage | 3 years -20C powder |
| IUPAC Name | (2S)-7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C27H32O14/c1-10-20(32)22(34)24(36)26(37-10)41-25-23(35)21(33)18(9-28)40-27(25)38-13-6-14(30)19-15(31)8-16(39-17(19)7-13)11-2-4-12(29)5-3-11/h2-7,10,16,18,20-30,32-36H,8-9H2,1H3/t10-,16-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | DFPMSGMNTNDNHN-ZPHOTFPESA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC3=CC(=C4C(=O)C[C@H](OC4=C3)C5=CC=C(C=C5)O)O)CO)O)O)O)O)O |
| Reference | <p style=/line-height:25px/> |
