For research use only. Not for therapeutic Use.
Nateglinide-d5 Ethyl Ester is a deuterated form of nateglinide, an oral antidiabetic medication used to manage blood glucose levels in type 2 diabetes. In this version, five hydrogen atoms are replaced with deuterium, enhancing its utility in pharmacokinetic and metabolic studies. The ethyl ester modification improves the compound’s solubility and stability. The deuterium labeling allows for precise tracking and analysis using mass spectrometry and NMR spectroscopy, facilitating detailed research into the drug’s absorption, distribution, metabolism, and excretion, while retaining its pharmacological properties.
| CAS Number | 1356929-50-4 |
| Synonyms | N-[[trans-4-(1-Methylethyl)cyclohexyl]carbonyl]-D-(phenyl-d5)alanine Ethyl Ester; |
| Molecular Formula | C21H31NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl (2R)-3-(2,3,4,5,6-pentadeuteriophenyl)-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoate |
| InChI | InChI=1S/C21H31NO3/c1-4-25-21(24)19(14-16-8-6-5-7-9-16)22-20(23)18-12-10-17(11-13-18)15(2)3/h5-9,15,17-19H,4,10-14H2,1-3H3,(H,22,23)/t17?,18?,19-/m1/s1/i5D,6D,7D,8D,9D |
| InChIKey | AVOHCDLQBWDQOF-MRVSTDCPSA-N |
| SMILES | CCOC(=O)C(CC1=CC=CC=C1)NC(=O)C2CCC(CC2)C(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
