For research use only. Not for therapeutic Use.
Nav1.8-IN-4(CAT: I040690) is a selective inhibitor of the voltage-gated sodium channel Nav1.8, which is predominantly expressed in peripheral sensory neurons and plays a critical role in pain signal transmission. By selectively targeting Nav1.8, this compound effectively blocks action potential propagation in nociceptive pathways without affecting other sodium channel subtypes, reducing off-target effects. Nav1.8-IN-4 has demonstrated potent analgesic potential in preclinical pain models, making it a valuable research tool for studying pain mechanisms and developing non-opioid therapeutics. Its selectivity and efficacy position it as a promising lead compound in the treatment of chronic and inflammatory pain disorders.
| CAS Number | 1620846-16-3 |
| Synonyms | 2-(4-fluoro-2-methylphenoxy)-N-(2-oxo-1H-pyridin-4-yl)-4-(trifluoromethyl)benzamide |
| Molecular Formula | C20H14F4N2O3 |
| Purity | ≥95% |
| IUPAC Name | 2-(4-fluoro-2-methylphenoxy)-N-(2-oxo-1H-pyridin-4-yl)-4-(trifluoromethyl)benzamide |
| InChI | InChI=1S/C20H14F4N2O3/c1-11-8-13(21)3-5-16(11)29-17-9-12(20(22,23)24)2-4-15(17)19(28)26-14-6-7-25-18(27)10-14/h2-10H,1H3,(H2,25,26,27,28) |
| InChIKey | YXHMFJXQQXHKRO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)OC2=C(C=CC(=C2)C(F)(F)F)C(=O)NC3=CC(=O)NC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
