For research use only. Not for therapeutic Use.
Naxagolide (Cat.No:I012375) is a selective dopamine D2 receptor agonist primarily used in the treatment of Parkinson’s disease. It acts by stimulating dopamine receptors in the brain, helping to restore proper dopamine balance and alleviate motor symptoms associated with the condition. Naxagolide is a non-ergot derivative and is well-tolerated with fewer side effects compared to other dopamine agonists.
| CAS Number | 88058-88-2 |
| Synonyms | PHNO; Dopazinol; (+)-Propyl-hexahydro-naphtho-oxazin; (4aR,10bR)-4-Propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-9-ol |
| Molecular Formula | C15H21NO2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| IUPAC Name | (4aR,10bR)-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazin-9-ol |
| InChI | InChI=1S/C15H21NO2/c1-2-7-16-8-9-18-15-13-10-12(17)5-3-11(13)4-6-14(15)16/h3,5,10,14-15,17H,2,4,6-9H2,1H3/t14-,15-/m1/s1 |
| InChIKey | JCSREICEMHWFAY-HUUCEWRRSA-N |
| SMILES | CCCN1CCOC2C1CCC3=C2C=C(C=C3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
