For research use only. Not for therapeutic Use.
Naxifylline is a xanthine derivative with potential applications in respiratory research. It functions as a selective adenosine receptor antagonist, particularly targeting the A1 receptor, which plays a role in bronchoconstriction and inflammation in conditions like asthma and chronic obstructive pulmonary disease (COPD). By blocking the A1 receptor, naxifylline may reduce airway constriction and improve airflow, offering therapeutic potential in treating respiratory diseases. Its action on adenosine receptors also suggests potential for modulating inflammation, making it a valuable compound for studying respiratory pharmacology and developing treatments for asthma and related conditions.
| Catalog Number | I008248 |
| CAS Number | 166374-49-8 |
| Synonyms | BG9719; CVT-124; CVT124; CVT 124; Naxifylline;1,3-dipropyl-8-((1R,2R,4R,5R,6R)-3-oxatricyclo[3.2.1.02,4]octan-6-yl)-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Formula | C18H24N4O3 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| InChI | InChI=1S/C18H24N4O3/c1-3-5-21-16-12(17(23)22(6-4-2)18(21)24)19-15(20-16)11-8-9-7-10(11)14-13(9)25-14/h9-11,13-14H,3-8H2,1-2H3,(H,19,20)/t9-,10+,11+,13-,14+/m1/s1 |
| InChIKey | OQCJPFYWFGUHIN-GJKBLCTNSA-N |
| SMILES | CCCN1C2=C(C(=O)N(C1=O)CCC)NC(=N2)C3CC4CC3C5C4O5 |
