For research use only. Not for therapeutic Use.
NCC-149（Cat No.:M014188）is a selective small molecule inhibitor designed to target specific protein kinases involved in cancer cell proliferation and survival. By inhibiting these kinases, NCC-149 disrupts critical signaling pathways that drive tumor growth and metastasis. Preclinical studies have demonstrated its potential in blocking the progression of various cancers, including breast, lung, and colon cancer. NCC-149’s targeted mechanism of action offers a promising therapeutic approach with minimal off-target effects, positioning it as a potential candidate for further clinical development in cancer treatment.
| CAS Number | 1316652-41-1 |
| Synonyms | N-hydroxy-3-[1-(phenylsulfanylmethyl)triazol-4-yl]benzamide |
| Molecular Formula | C16H14N4O2S |
| Purity | ≥95% |
| IUPAC Name | N-hydroxy-3-[1-(phenylsulfanylmethyl)triazol-4-yl]benzamide |
| InChI | InChI=1S/C16H14N4O2S/c21-16(18-22)13-6-4-5-12(9-13)15-10-20(19-17-15)11-23-14-7-2-1-3-8-14/h1-10,22H,11H2,(H,18,21) |
| InChIKey | DORPIZJGSLWDIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SCN2C=C(N=N2)C3=CC(=CC=C3)C(=O)NO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
