For research use only. Not for therapeutic Use.
NCH-51（Cat No.:I005086）is a potent and selective inhibitor of the histone demethylase LSD1 (lysine-specific demethylase 1), an enzyme that regulates gene expression by removing methyl groups from histones, particularly H3K4 and H3K9. By inhibiting LSD1, NCH-51 disrupts epigenetic regulation, leading to reactivation of tumor suppressor genes and induction of differentiation and apoptosis in cancer cells. It has shown promise in preclinical studies, especially in treating acute myeloid leukemia (AML) and other hematological malignancies. NCH-51 is being explored as a potential therapeutic agent in cancer treatment, with ongoing research to enhance its clinical efficacy.
| Catalog Number | I005086 |
| CAS Number | 848354-66-5 |
| Synonyms | S-[7-oxo-7-[(4-phenyl-1,3-thiazol-2-yl)amino]heptyl] 2-methylpropanethioate |
| Molecular Formula | C₂₀H₂₆N₂O₂S₂ |
| Purity | ≥95% |
| Target | HDAC |
| Solubility | DMSO:26mg/mL |
| Storage | Store at 4°C |
| IC50 | 1-10 μM (EC50) |
| IUPAC Name | S-[7-oxo-7-[(4-phenyl-1,3-thiazol-2-yl)amino]heptyl] 2-methylpropanethioate |
| InChI | InChI=1S/C20H26N2O2S2/c1-15(2)19(24)25-13-9-4-3-8-12-18(23)22-20-21-17(14-26-20)16-10-6-5-7-11-16/h5-7,10-11,14-15H,3-4,8-9,12-13H2,1-2H3,(H,21,22,23) |
| InChIKey | MDYDGUOQFUQOGE-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)SCCCCCCC(=O)NC1=NC(=CS1)C2=CC=CC=C2 |
| Reference | <p style=/line-height:25px/> </p> |
