For research use only. Not for therapeutic Use.
Nebivolol（Cat No.:A000550）is a selective beta-1 adrenergic receptor blocker used to treat hypertension and heart failure. It reduces heart rate and dilates blood vessels, lowering blood pressure and decreasing the workload on the heart. Unlike traditional beta-blockers, Nebivolol also promotes the release of nitric oxide, contributing to its vasodilatory effect, which enhances its ability to reduce blood pressure without significantly impacting heart function. Its dual mechanism makes it a well-tolerated option for patients, particularly those with cardiovascular conditions requiring both beta-blockade and improved vascular function.
| Catalog Number | A000550 |
| CAS Number | 152520-56-4 |
| Synonyms | R-65824 |
| Molecular Formula | C22H26ClF2NO4 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | 3 years -20C powder |
| IUPAC Name | (1S)-1-[(2S)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]-2-[[(2S)-2-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]-2-hydroxyethyl]amino]ethanol;hydrochloride |
| InChI | InChI=1S/C22H25F2NO4.ClH/c23-15-3-7-19-13(9-15)1-5-21(28-19)17(26)11-25-12-18(27)22-6-2-14-10-16(24)4-8-20(14)29-22;/h3-4,7-10,17-18,21-22,25-27H,1-2,5-6,11-12H2;1H/t17-,18-,21-,22+;/m0./s1 |
| InChIKey | JWEXHQAEWHKGCW-BIISKSHESA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)O[C@H]1[C@H](CNC[C@@H]([C@@H]3CCC4=C(O3)C=CC(=C4)F)O)O.Cl |
