For research use only. Not for therapeutic Use.
Neferine（Cat No.:I002749）is a natural alkaloid compound primarily found in the seeds of the lotus plant (Nelumbo nucifera). It has gained attention for its potential medicinal properties, including anti-inflammatory, antioxidant, and neuroprotective effects. Neferine is believed to support cardiovascular health by improving blood flow and reducing oxidative stress. Some studies also suggest its potential benefits in protecting against neurodegenerative diseases like Alzheimer’s. Although promising, more research is needed to fully understand its mechanisms, safety, and effectiveness in clinical applications. Neferine is being investigated as a potential therapeutic agent for various conditions.
| Catalog Number | I002749 |
| CAS Number | 2292-16-2 |
| Molecular Formula | C38H44N2O6 |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | DMSO ≥ 15 mg/mL |
| Storage | -20°C |
| IUPAC Name | 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]-2-[[(1R)-6-methoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]phenol |
| InChI | InChI=1S/C38H44N2O6/c1-39-15-14-27-21-36(44-5)38(23-30(27)31(39)17-24-7-10-28(42-3)11-8-24)46-34-19-25(9-12-33(34)41)18-32-29-22-37(45-6)35(43-4)20-26(29)13-16-40(32)2/h7-12,19-23,31-32,41H,13-18H2,1-6H3/t31-,32-/m1/s1 |
| InChIKey | MIBATSHDJRIUJK-ROJLCIKYSA-N |
| SMILES | CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)OC)OC4=C(C=CC(=C4)C[C@@H]5C6=CC(=C(C=C6CCN5C)OC)OC)O)OC |
