For research use only. Not for therapeutic Use.
Nelfinavir (CAT: I002032) is an antiretroviral medication that belongs to the class of drugs known as protease inhibitors. It is primarily used for the treatment of HIV infection. Nelfinavir works by inhibiting the protease enzyme, which is responsible for the cleavage of viral polyproteins into functional proteins needed for the replication of HIV. By blocking this enzyme, nelfinavir helps to reduce the viral load and slow down the progression of HIV infection. Additionally, nelfinavir has also been investigated for its potential in the treatment of certain cancers due to its ability to inhibit various cellular pathways involved in tumor growth and survival.
| Catalog Number | I002032 |
| CAS Number | 159989-64-7 |
| Synonyms | (3S,4aS,8aS)-N-tert-butyl-2-[(2R,3R)-2-hydroxy-3-[(3-hydroxy-2-methylbenzoyl)amino]-4-phenylsulfanylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| Molecular Formula | C32H45N3O4S |
| Purity | ≥95% |
| Target | HIV Integrase |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20C |
| Overview of Clinical Research | <p> |
| IC50 | 2 nM (Ki for HIV-1 protease) |
| IUPAC Name | (3S,4aS,8aS)-N-tert-butyl-2-[(2R,3R)-2-hydroxy-3-[(3-hydroxy-2-methylbenzoyl)amino]-4-phenylsulfanylbutyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| InChI | InChI=1S/C32H45N3O4S/c1-21-25(15-10-16-28(21)36)30(38)33-26(20-40-24-13-6-5-7-14-24)29(37)19-35-18-23-12-9-8-11-22(23)17-27(35)31(39)34-32(2,3)4/h5-7,10,13-16,22-23,26-27,29,36-37H,8-9,11-12,17-20H2,1-4H3,(H,33,38)(H,34,39)/t22-,23+,26-,27-,29+/m0/s1 |
| InChIKey | QAGYKUNXZHXKMR-HKWSIXNMSA-N |
| SMILES | CC1=C(C=CC=C1O)C(=O)NC(CSC2=CC=CC=C2)C(CN3CC4CCCCC4CC3C(=O)NC(C)(C)C)O |
| Reference | <p style=”/line-height:25px/”> |
