For research use only. Not for therapeutic Use.
Neoechinulin A (CAT: R016762) is a natural fungal secondary metabolite with notable bioactivity and potential pharmaceutical applications. It belongs to the class of alkaloids and is produced by various fungal species. Neoechinulin A has been studied for its antimicrobial properties, showing inhibitory effects against certain bacteria and fungi. Additionally, it displays cytotoxic activity against cancer cells, making it a subject of interest in cancer research. Its ability to modulate enzymes and cellular processes makes it a candidate for drug development. While its pharmacological potential is promising, further studies are essential to fully understand its mechanisms and therapeutic uses.
CAS Number | 51551-29-2 |
Molecular Formula | C19H21N3O2 |
Purity | ≥95% |
Target | Apoptosis |
Storage | store at -20℃ |
IUPAC Name | (3S,6Z)-3-methyl-6-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methylidene]piperazine-2,5-dione |
InChI | 1S/C19H21N3O2/c1-5-19(3,4)16-13(12-8-6-7-9-14(12)21-16)10-15-18(24)20-11(2)17(23)22-15/h5-11,21H,1H2,2-4H3,(H,20,24)(H,22,23)/b15-10-/t11-/m0/s1 |
InChIKey | MYRPIYZIAHOECW-SAIXKJTDSA-N |
SMILES | C[C@H]1C(=O)N/C(=C\C2=C(NC3=CC=CC=C32)C(C)(C)C=C)/C(=O)N1 |