For research use only. Not for therapeutic Use.
Nepodin(Cat No.:R066369)is a naturally occurring anthraquinone derivative found in certain medicinal plants, including Rumex species. It exhibits various pharmacological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. Nepodin has been traditionally used in herbal medicine to treat ailments like gastrointestinal disorders and skin infections. Recent studies highlight its potential as an antidiabetic agent due to its ability to enhance glucose metabolism and insulin sensitivity. Additionally, nepodin has shown cytotoxic effects on cancer cells, making it a candidate for further research in oncology. Its diverse bioactivities support its importance in medicinal chemistry.
CAS Number | 3785-24-8 |
Molecular Formula | C13H12O3 |
Purity | ≥95% |
Target | PI3K/Akt/mTOR |
Storage | 4°C, protect from light |
IUPAC Name | 1-(1,8-dihydroxy-3-methylnaphthalen-2-yl)ethanone |
InChI | InChI=1S/C13H12O3/c1-7-6-9-4-3-5-10(15)12(9)13(16)11(7)8(2)14/h3-6,15-16H,1-2H3 |
InChIKey | DMLHPCALHMPJHS-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C(=CC=C2)O)C(=C1C(=O)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |