For research use only. Not for therapeutic Use.
Nepodin (Cat No.:R066369) is a compound found in Rumex crispus, known as a quinone oxidoreductase (PfNDH2) inhibitor. It has been shown to activate AMPK, promoting the translocation of GLUT4 to the plasma membrane, potentially aiding in glucose uptake. Moreover, Nepodin exhibits antidiabetic effects, making it a promising candidate for diabetes treatment. Additionally, its antimalarial properties indicate potential therapeutic applications against malaria.
| Catalog Number | R066369 |
| CAS Number | 3785-24-8 |
| Molecular Formula | C13H12O3 |
| Purity | ≥95% |
| Storage | 4°C, protect from light |
| IUPAC Name | 1-(1,8-dihydroxy-3-methylnaphthalen-2-yl)ethanone |
| InChI | InChI=1S/C13H12O3/c1-7-6-9-4-3-5-10(15)12(9)13(16)11(7)8(2)14/h3-6,15-16H,1-2H3 |
| InChIKey | DMLHPCALHMPJHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C(=C1)C=CC=C2O)O)C(=O)C |
