For research use only. Not for therapeutic Use.
Neratinib(CAT: I004621) is an orally available small-molecule inhibitor that targets several tyrosine kinases, including HER1 (EGFR), HER2 (ErbB2), and HER4 (ErbB4). It is used for the treatment of certain types of breast cancer, particularly HER2-positive breast cancer, which is characterized by an overexpression of HER2 receptors. Neratinib works by irreversibly binding to the tyrosine kinase domains of these receptors, thereby inhibiting their signaling pathways involved in cell growth and proliferation. This inhibition helps to suppress the growth and spread of cancer cells.
| Catalog Number | I004621 |
| CAS Number | 698387-09-6 |
| Synonyms | HKI-272 |
| Molecular Formula | C₃₀H₂₉ClN₆O₃ |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | DMSO：＜ 5.6 mg/mL |
| Storage | Store at -20°C |
| IC50 | 59 nM/92 nM (HER2/EGFR) |
| IUPAC Name | (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-ethoxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide |
| InChI | InChI=1S/C30H29ClN6O3/c1-4-39-28-16-25-23(15-26(28)36-29(38)9-7-13-37(2)3)30(20(17-32)18-34-25)35-21-10-11-27(24(31)14-21)40-19-22-8-5-6-12-33-22/h5-12,14-16,18H,4,13,19H2,1-3H3,(H,34,35)(H,36,38)/b9-7+ |
| InChIKey | JWNPDZNEKVCWMY-VQHVLOKHSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)N=CC(=C2NC3=CC(=C(C=C3)OCC4=CC=CC=N4)Cl)C#N)NC(=O)C=CCN(C)C |
