For research use only. Not for therapeutic Use.
Nerol(CAT: R015863) is a natural compound and a monoterpenoid alcohol. Its mode of action involves being a fragrance and flavor ingredient commonly found in essential oils of certain plants, such as roses and lemongrass. Nerol has a pleasant, sweet, and floral aroma, making it valuable in the perfume and cosmetic industries. Additionally, it is used as a flavoring agent in the food industry, contributing to the taste and aroma of various food products. As a natural compound, Nerol also possesses potential health benefits and has been studied for its antioxidant and antimicrobial properties.
Catalog Number | R015863 |
CAS Number | 106-25-2 |
Synonyms | (2Z)-3,7-Dimethyl-2,6-octadien-1-ol; (Z)-3,7-Dimethyl-2,6-octadien-1-ol; (Z)-3,7-Dimethyl-2,6-octadienol; (Z)-Geraniol; (Z)-Nerol; 2-cis-3,7-Dimethyl-2,6-octadien-1-ol; 3,7-Dimethyl-cis-2,6-octadien-1-ol; Nerol 900; Neryl Alcohol; cis-3,7-Dimethyl-2, |
Molecular Formula | C10H18O |
Purity | ≥95% |
Target | NF-κB |
Storage | -20°C |
IUPAC Name | (2Z)-3,7-dimethylocta-2,6-dien-1-ol |
InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7- |
InChIKey | GLZPCOQZEFWAFX-YFHOEESVSA-N |
SMILES | CC(=CCCC(=CCO)C)C |