Netarsudil dihydrochloride（Cat No.:I010945）is a pharmaceutical agent primarily used to treat elevated intraocular pressure in conditions like glaucoma and ocular hypertension. It works as a Rho kinase inhibitor, which enhances aqueous humor outflow and reduces intraocular pressure. Administered as an eye drop, it is effective in lowering pressure through a dual mechanism: increasing outflow via the trabecular pathway and decreasing aqueous humor production. Netarsudil is often prescribed when other treatments are inadequate, offering a valuable option for managing chronic eye conditions and preserving vision.
| Catalog Number | I010945 |
| CAS Number | 1253952-02-1 |
| Molecular Formula | C28H29Cl2N3O3 |
| Purity | ≥95% |
| IUPAC Name | [4-[(2S)-3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl]methyl 2,4-dimethylbenzoate;dihydrochloride |
| InChI | InChI=1S/C28H27N3O3.2ClH/c1-18-3-10-25(19(2)13-18)28(33)34-17-20-4-6-21(7-5-20)26(15-29)27(32)31-24-9-8-23-16-30-12-11-22(23)14-24;;/h3-14,16,26H,15,17,29H2,1-2H3,(H,31,32);2*1H/t26-;;/m1../s1 |
| InChIKey | LDKTYVXXYUJVJM-FBHGDYMESA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)OCC2=CC=C(C=C2)[C@@H](CN)C(=O)NC3=CC4=C(C=C3)C=NC=C4)C.Cl.Cl |
