For research use only. Not for therapeutic Use.
Neticonazole（Cat No.:M110568）is an imidazole antifungal agent primarily studied for its potent activity against a variety of fungal pathogens, including dermatophytes and Candida species. It works by inhibiting ergosterol synthesis, a key component of fungal cell membranes, leading to impaired cell function and fungal death. Neticonazole is commonly used in topical formulations to treat superficial fungal infections, such as athlete’s foot and ringworm. Its broad-spectrum efficacy, low systemic absorption, and favorable safety profile make it an important focus in antifungal research and pharmaceutical development for optimized treatment options.
| Catalog Number | M110568 |
| CAS Number | 130726-68-0 |
| Molecular Formula | C17H22N2OS |
| Purity | ≥95% |
| Target | Fungal |
| Storage | Desiccate at -20C |
| IUPAC Name | 1-[(E)-2-methylsulfanyl-1-(2-pentoxyphenyl)ethenyl]imidazole |
| InChI | InChI=1S/C17H22N2OS/c1-3-4-7-12-20-17-9-6-5-8-15(17)16(13-21-2)19-11-10-18-14-19/h5-6,8-11,13-14H,3-4,7,12H2,1-2H3/b16-13+ |
| InChIKey | VWOIKFDZQQLJBJ-DTQAZKPQSA-N |
| SMILES | CCCCCOC1=CC=CC=C1/C(=C\SC)/N2C=CN=C2 |
