For research use only. Not for therapeutic Use.
Neurotensin(8-13) (CAT: I013422) is a peptide fragment derived from the larger neuropeptide called neurotensin. Neurotensin(8-13) specifically corresponds to the amino acid sequence from position 8 to 13 of the neurotensin peptide. It exhibits similar pharmacological activities as full-length neurotensin, including modulation of neurotransmission, regulation of gastrointestinal motility, and involvement in pain modulation. Neurotensin(8-13) is known to interact with specific neurotensin receptors, primarily the NTS1 receptor subtype, to elicit its physiological effects. Research on neurotensin and its fragments, including Neurotensin(8-13), is ongoing to better understand their roles in various biological processes and explore their potential therapeutic applications.
Catalog Number | I013422 |
CAS Number | 60482-95-3 |
Molecular Formula | C₃₈H₆₄N₁₂O₈ |
Purity | ≥95% |
Target | Peptides |
Solubility | H2O |
IUPAC Name | (2S)-2-[[(2S,3S)-2-[[(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-4-methylpentanoic acid |
InChI | InChI=1S/C38H64N12O8/c1-5-22(4)30(34(55)48-28(36(57)58)19-21(2)3)49-32(53)27(20-23-12-14-24(51)15-13-23)47-33(54)29-11-8-18-50(29)35(56)26(10-7-17-45-38(42)43)46-31(52)25(39)9-6-16-44-37(40)41/h12-15,21-22,25-30,51H,5-11,16-20,39H2,1-4H3,(H,46,52)(H,47,54)(H,48,55)(H,49,53)(H,57,58)(H4,40,41,44)(H4,42,43,45)/t22-,25-,26-,27-,28-,29-,30-/m0/s1 |
InChIKey | DQDBCHHEIKQPJD-ODKJCKIQSA-N |
SMILES | CCC(C)C(C(=O)NC(CC(C)C)C(=O)O)NC(=O)C(CC1=CC=C(C=C1)O)NC(=O)C2CCCN2C(=O)C(CCCN=C(N)N)NC(=O)C(CCCN=C(N)N)N |
Reference | 1. García-Garayoa E, et al. Preclinical evaluation of a new, stabilized neurotensin(8–13) pseudopeptide radiolabeled with (99m)tc. J Nucl Med. 2002 Mar;43(3):374-83. |