For research use only. Not for therapeutic Use.
Nevadensin（Cat No.:R074707）is a naturally occurring flavonoid found in the herb Salvia lavandulifolia and other Lamiaceae family plants. It exhibits multiple biological activities, including anti-inflammatory, antioxidant, and anticancer properties, making it a promising compound for therapeutic research. Nevadensin has been shown to inhibit certain enzymes, such as cyclooxygenase-2 (COX-2), contributing to its anti-inflammatory effects. Additionally, its antioxidant properties help neutralize free radicals, which may protect cells from oxidative damage. With these potential health benefits, nevadensin is studied for applications in pharmaceuticals, nutraceuticals, and functional foods.
| Catalog Number | R074707 |
| CAS Number | 10176-66-6 |
| Molecular Formula | C18H16O7 |
| Purity | ≥95% |
| Target | Bacterial |
| IUPAC Name | 5,7-dihydroxy-6,8-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChI | InChI=1S/C18H16O7/c1-22-10-6-4-9(5-7-10)12-8-11(19)13-14(20)17(23-2)15(21)18(24-3)16(13)25-12/h4-8,20-21H,1-3H3 |
| InChIKey | KRFBMPVGAYGGJE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C(=C3O2)OC)O)OC)O |
