For research use only. Not for therapeutic Use.
Nevirapine(Cat No.:A000432)is a high-purity non-nucleoside reverse transcriptase inhibitor (NNRTI) widely used in HIV research. It targets the HIV-1 reverse transcriptase enzyme by binding to an allosteric site, disrupting viral DNA synthesis and replication. Nevirapine is pivotal in studying antiretroviral therapy mechanisms, resistance patterns, and combination treatments. Known for its oral bioavailability and effectiveness, it is extensively used in exploring strategies to prevent mother-to-child HIV transmission. Its stability and efficacy make it a valuable tool for advancing HIV treatment research and developing innovative therapeutic approaches.
CAS Number | 129618-40-2 |
Synonyms | 129618-40-2; Viramune; BI-RG-587; Viramune XR; BIRG 0587 |
Molecular Formula | C15H14N4O |
Purity | ≥95% |
Target | HIV |
Solubility | >13.3mg/mL in DMSO |
Storage | -20°C |
IUPAC Name | 2-cyclopropyl-7-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-10-one |
InChI | InChI=1S/C15H14N4O/c1-9-6-8-17-14-12(9)18-15(20)11-3-2-7-16-13(11)19(14)10-4-5-10/h2-3,6-8,10H,4-5H2,1H3,(H,18,20) |
InChIKey | NQDJXKOVJZTUJA-UHFFFAOYSA-N |
SMILES | CC1=C2C(=NC=C1)N(C3=C(C=CC=N3)C(=O)N2)C4CC4 |
Reference | 1: Huang L, Carey V, Lindsey JC, Marzan F, Gingrich D, Graham B, Barlow-Mosha L, 2: Offor U, Ajayi SA, Jegede IA, Kharwa S, Naidu EC, Azu OO. Renal 3: Padmapriyadarsini C, Ramesh K, Sekar L, Ramachandran G, Reddy D, Narendran G, 4: Eloy P, Tessier A, Fan-Havard P, Chou M, Verstuyft C, Taburet AM, Haas DW, 5: Paemanee A, Sornjai W, Kittisenachai S, Sirinonthanawech N, Roytrakul S, 6: Gopalan BP, Mehta K, D/’souza RR, Rajnala N, A K HK, Ramachandran G, Shet A. 7: Pavlos R, McKinnon EJ, Ostrov DA, Peters B, Buus S, Koelle D, Chopra A, 8: Moghadam NH, Salehzadeh S, Shahabadi N. Spectroscopic and molecular docking 9: Prasertvit P, Chareonyingwattana A, Wattanakrai P. Nevirapine patch testing in 10: Ciccacci C, Latini A, Politi C, Mancinelli S, Marazzi MC, Novelli G, Palombi |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |