For research use only. Not for therapeutic Use.
NFATc1-IN-1（Cat No.:I043369）is a selective small molecule inhibitor targeting NFATc1, a transcription factor involved in regulating immune cell activation and differentiation. By specifically blocking NFATc1, this compound inhibits pathways that contribute to inflammatory diseases, autoimmune disorders, and certain cancers. NFATc1-IN-1 has shown promise in preclinical studies for modulating immune responses and preventing the progression of conditions such as rheumatoid arthritis and osteoclast-mediated bone resorption. Its targeted action makes it a potential therapeutic candidate for conditions characterized by excessive immune activation and inflammation.
| CAS Number | 1912422-56-0 |
| Synonyms | 5-fluoro-N-(2-fluoro-4-iodophenyl)-2-hydroxybenzamide |
| Molecular Formula | C13H8F2INO2 |
| Purity | ≥95% |
| IUPAC Name | 5-fluoro-N-(2-fluoro-4-iodophenyl)-2-hydroxybenzamide |
| InChI | InChI=1S/C13H8F2INO2/c14-7-1-4-12(18)9(5-7)13(19)17-11-3-2-8(16)6-10(11)15/h1-6,18H,(H,17,19) |
| InChIKey | IGRCFOGPIJEESA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)NC2=C(C=C(C=C2)I)F)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
