For research use only. Not for therapeutic Use.
NIAD-4（Cat No.:R065807）is a small molecule compound with potential therapeutic applications in neurodegenerative diseases, particularly Alzheimer’s disease. It functions by inhibiting the aggregation of amyloid-beta peptides, which are associated with the formation of plaques in the brain and contribute to cognitive decline. NIAD-4 has shown promise in preclinical studies by reducing amyloid plaque burden and improving cognitive function in animal models. Its ability to modulate amyloid-beta aggregation makes it a potential candidate for developing treatments that target the underlying mechanisms of Alzheimer’s disease and other neurodegenerative disorders.
| CAS Number | 868592-56-7 |
| Synonyms | 2-[[5-[5-(4-hydroxyphenyl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
| Molecular Formula | C18H10N2OS2 |
| Purity | ≥95% |
| IUPAC Name | 2-[[5-[5-(4-hydroxyphenyl)thiophen-2-yl]thiophen-2-yl]methylidene]propanedinitrile |
| InChI | InChI=1S/C18H10N2OS2/c19-10-12(11-20)9-15-5-6-17(22-15)18-8-7-16(23-18)13-1-3-14(21)4-2-13/h1-9,21H |
| InChIKey | KLFRZDOQQDHVSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(S2)C3=CC=C(S3)C=C(C#N)C#N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
