For research use only. Not for therapeutic Use.
NIC-0102（Cat No.:I042864）is an orally active proteasome inhibitor (pIC₅₀ = 7.55) that specifically inhibits NLRP3 inflammasome activation. It induces polyubiquitination of NLRP3, interfering with NLRP3-ASC interaction and blocking ASC oligomerization, thereby inhibiting NLRP3 inflammasome activation. In vitro studies show that NIC-0102 inhibits the release of IL-1β in a dose-dependent manner. In vivo, NIC-0102 demonstrates potent anti-inflammatory effects in a dextran sulfate sodium (DSS)-induced ulcerative colitis model, significantly reducing weight loss, fecal occult blood, and colonic shortening. Pharmacokinetic evaluations in mice indicate a half-life of 4.73 hours (intravenous) and 8.36 hours (oral), with an oral bioavailability of 48.1%.
| CAS Number | 2806031-94-5 |
| Synonyms | [(1R)-1-[[(2S)-2-[(2,6-difluorobenzoyl)amino]-3-phenylpropanoyl]amino]-3-methylbutyl]boronic acid |
| Molecular Formula | C21H25BF2N2O4 |
| Purity | ≥95% |
| IUPAC Name | [(1R)-1-[[(2S)-2-[(2,6-difluorobenzoyl)amino]-3-phenylpropanoyl]amino]-3-methylbutyl]boronic acid |
| InChI | InChI=1S/C21H25BF2N2O4/c1-13(2)11-18(22(29)30)26-20(27)17(12-14-7-4-3-5-8-14)25-21(28)19-15(23)9-6-10-16(19)24/h3-10,13,17-18,29-30H,11-12H2,1-2H3,(H,25,28)(H,26,27)/t17-,18-/m0/s1 |
| InChIKey | QTRFWSIBLJYXFJ-ROUUACIJSA-N |
| SMILES | B([C@H](CC(C)C)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C2=C(C=CC=C2F)F)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
