For research use only. Not for therapeutic Use.
Nicarbazine(Cat No.:R019982)is a veterinary pharmaceutical used primarily as an anticoccidial agent in poultry. It is a combination of two active components: dinitrocarbanilide and dimethylpyrimidinol, which work synergistically to disrupt the development of coccidia, a parasitic protozoan that causes coccidiosis. By inhibiting sporozoite function and energy metabolism, Nicarbazine effectively prevents and controls outbreaks in broiler and layer chickens, improving feed efficiency and growth. Its use contributes to maintaining poultry health and production quality. Proper usage is essential to ensure food safety and minimize resistance development.
CAS Number | 330-95-0 |
Synonyms | N,N’-bis(4-nitrophenyl)urea compd. with 4,6-Dimethyl-2(1H)-pyrimidinone; 4,4’-Dinitrocarbanilide compd. with 4,6-Dimethyl-2-pyrimidinol; 4,6-Dimethyl-2-pyrimidinol compd. with 4,4’-Dinitrocarbanilide; MK 75; NSC 7171; Nicarb; Nicarbazin; Nicoxin; Nic |
Molecular Formula | C19H18N6O6 |
Purity | ≥95% |
Target | Parasite |
Storage | -20°C |
IUPAC Name | 1,3-bis(4-nitrophenyl)urea;4,6-dimethyl-1H-pyrimidin-2-one |
InChI | InChI=1S/C13H10N4O5.C6H8N2O/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22;1-4-3-5(2)8-6(9)7-4/h1-8H,(H2,14,15,18);3H,1-2H3,(H,7,8,9) |
InChIKey | UKHWDRMMMYWSFL-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC(=O)N1)C.C1=CC(=CC=C1NC(=O)NC2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Reference | Nicarbazin Pesticide Fact Sheet (2005). United States Environmental Protection Agency.</span></p> |