For research use only. Not for therapeutic Use.
Nicardipine HCl is a dihydropyridine calcium channel blocker widely used in cardiovascular research for its potent vasodilatory effects. By inhibiting L-type calcium channels, it reduces calcium influx into vascular smooth muscle cells, promoting arterial relaxation and lowering blood pressure. Nicardipine is highly effective in treating hypertension, angina, and ischemic conditions. Its rapid onset and short half-life make it valuable for studying acute blood pressure management and cerebrovascular protection, especially in critical care settings, highlighting its role in cardiovascular therapeutics.
| Catalog Number | A000695 |
| CAS Number | 54527-84-3 |
| Synonyms | RS-69216 |
| Molecular Formula | C26H29N3O6 • HCl |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
| InChI | 1S/C26H29N3O6.ClH/c1-17-22(25(30)34-4)24(20-11-8-12-21(15-20)29(32)33)23(18(2)27-17)26(31)35-14-13-28(3)16-19-9-6-5-7-10-19;/h5-12,15,24,27H,13-14,16H2,1-4H3;1H |
| InChIKey | AIKVCUNQWYTVTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCCN(C)CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC.Cl |
