For research use only. Not for therapeutic Use.
Niclosamide (Cat.No:A000928) is an anthelmintic drug used to treat tapeworm infections in humans and animals. It works by disrupting the energy production process in the parasites, leading to their death. In recent research, niclosamide has shown promise for its potential anti-cancer, anti-inflammatory, and antiviral properties.
CAS Number | 50-65-7 |
Synonyms | 50-65-7; 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide; Niclocide; Bayluscid; Phenasal |
Molecular Formula | C₁₃H₈Cl₂N₂O₄ |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | >12.75mg/mL in DMSO |
Storage | -20°C |
IUPAC Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
InChI | InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h1-6,18H,(H,16,19) |
InChIKey | RJMUSRYZPJIFPJ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NC(=O)C2=C(C=CC(=C2)Cl)O |