For research use only. Not for therapeutic Use.
Niclosamide monohydrate（Cat No.:I004728）is an anti-parasitic drug primarily used to treat intestinal worm infections, particularly tapeworms. It works by inhibiting the energy metabolism of the parasites, causing their disintegration and eventual elimination from the body. The monohydrate form of niclosamide includes one water molecule per molecule of niclosamide, enhancing its stability and solubility. Apart from its anthelmintic use, niclosamide has also shown potential in treating other conditions, such as certain cancers and metabolic disorders, through its effects on cellular metabolism and signaling pathways. It is available in tablet form for oral administration.
| Catalog Number | I004728 |
| CAS Number | 73360-56-2 |
| Synonyms | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide;hydrate |
| Molecular Formula | C13H10Cl2N2O5 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20℃ |
| IUPAC Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide;hydrate |
| InChI | InChI=1S/C13H8Cl2N2O4.H2O/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15;/h1-6,18H,(H,16,19);1H2 |
| InChIKey | ZBXRPLQCPHTHLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NC(=O)C2=C(C=CC(=C2)Cl)O.O |
