Nicotinamide-13C6（Cat No.:S000564） is an isotopically labeled form of nicotinamide, also known as niacinamide or vitamin B3, essential for cellular metabolism, DNA repair, and enzyme function. The “13C6” notation signifies that six carbon atoms in the nicotinamide molecule are replaced with the stable carbon isotope carbon-13. This isotopic labeling enables precise tracing of nicotinamide metabolism and its incorporation into biochemical pathways using advanced analytical techniques like mass spectrometry. Nicotinamide-13C6 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating diseases related to nicotinamide metabolism, such as pellagra and metabolic disorders.
| Catalog Number | S000564 |
| CAS Number | 2749910-55-0 |
| Molecular Formula | 13C6H6N2O |
| Purity | 95% |
| IUPAC Name | (2,3,4,5,6-13C5)pyridine-3-carboxamide |
| InChI | InChI=1S/C6H6N2O/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9)/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | DFPAKSUCGFBDDF-IDEBNGHGSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)N |
