For research use only. Not for therapeutic Use.
Nicotinamide arabinoside adenine dinucleotide (Cat No.:M013414) is a derivative of the coenzyme NAD+ (nicotinamide adenine dinucleotide), which is vital for energy metabolism and various biochemical reactions within cells. NAAD differs from NAD+ by having an arabinoside group instead of a ribose in its structure, affecting its biochemical properties and interactions. It plays a role in the biosynthesis of NAD+, acting as an intermediate in some metabolic pathways. Understanding and manipulating NAAD and its pathways can be crucial for developing therapeutic strategies against aging and various diseases, including metabolic disorders and neurodegenerative diseases.
Catalog Number | M013414 |
CAS Number | 108646-17-9 |
Synonyms | nicotinamide arabinoside adenine dinucleotide |
Molecular Formula | C21H27N7O14P2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S,3S,4S,5R)-5-[[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-2-(3-carbamoylpyridin-1-ium-1-yl)-4-hydroxyoxolan-3-olate |
InChI | InChI=1S/C21H27N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1-4,7-8,10-11,13-16,20-21,29-30,32H,5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,25)/t10-,11-,13-,14-,15+,16-,20+,21-/m1/s1 |
InChIKey | VOXRVZMOBSLKFE-DUYCQTTQSA-N |
SMILES | C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)O)O)O)[O-])C(=O)N |