For research use only. Not for therapeutic Use.
Nicotinamide Riboside Chloride is a form of vitamin B3 and a precursor to nicotinamide adenine dinucleotide (NAD+), a critical coenzyme involved in cellular energy metabolism and mitochondrial function. By boosting NAD+ levels, nicotinamide riboside chloride plays a role in promoting cellular repair, enhancing metabolic function, and supporting healthy aging. It is being researched for its potential to improve mitochondrial health, increase endurance, and treat metabolic disorders. Additionally, it shows promise in neuroprotection and combating age-related diseases by restoring cellular NAD+ levels, making it a valuable compound for both metabolic and longevity research.
CAS Number | 23111-00-4 |
Synonyms | Nicotinamide riboside; SRT647; SRT-647; SRT 647; Nicotinamide Riboside Triflate, α/β mixture;3-carbamoyl-1-((3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyridin-1-ium chloride |
Molecular Formula | C11H15ClN2O5 |
Purity | ≥95% |
Documentation | |
Target | Epigenetics |
Solubility | Soluble in DMSO |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide;chloride |
InChI | InChI=1S/C11H14N2O5.ClH/c12-10(17)6-2-1-3-13(4-6)11-9(16)8(15)7(5-14)18-11;/h1-4,7-9,11,14-16H,5H2,(H-,12,17);1H/t7-,8-,9-,11-;/m1./s1 |
InChIKey | YABIFCKURFRPPO-IVOJBTPCSA-N |
SMILES | C1=CC(=C[N+](=C1)C2C(C(C(O2)CO)O)O)C(=O)N.[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |