Nicotinic Acid-13C6(Cat No.: R002395) is a labeled form of nicotinic acid, also known as niacin or vitamin B3. Its mode of action involves being a derivative of nicotinic acid, where six carbon atoms are replaced with the stable isotope carbon-13 (13C). This labeling provides a unique molecular tracer for research and analytical purposes. Scientists use Nicotinic Acid-13C6 as an internal standard in mass spectrometry and other isotopic labeling studies to accurately quantify and identify nicotinic acid or related compounds in biological samples.
Catalog Number | R002395 |
CAS Number | 1189954-79-7 |
Synonyms | 3-Pyridinecarboxylic Acid-13C6; 3-Carboxylpyridine-13C6; 3-Carboxypyridine-13C6; Akotin-13C6; Apelagrin-13C6; Niacin-13C6; Niacor-13C6; Niaspan-13C6; Nicacid-13C6; Pelonin-13C6; Vitamin B3-13C6; Vitamin B5-13C6; Wampocap-13C6; β-Pyridinecarboxylic Ac |
Molecular Formula | C6H5NO2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | (2,3,4,5,6-13C5)pyridine-3-carboxylic acid |
InChI | InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)/i1+1,2+1,3+1,4+1,5+1,6+1 |
InChIKey | PVNIIMVLHYAWGP-IDEBNGHGSA-N |
SMILES | [13CH]1=[13CH][13C](=[13CH]N=[13CH]1)[13C](=O)O |