For research use only. Not for therapeutic Use.
Nicotinic acid riboside is a form of vitamin B3 (niacin) that combines nicotinic acid with ribose, enhancing its bioavailability. It serves as a precursor to NAD+ (nicotinamide adenine dinucleotide), a crucial coenzyme involved in cellular energy metabolism and DNA repair. Nicotinic acid riboside is studied for its potential to improve mitochondrial function, boost energy levels, and support overall cellular health. Its supplementation is explored for potential benefits in aging, metabolic disorders, and neuroprotection.
Catalog Number | R054252 |
CAS Number | 17720-18-2 |
Synonyms | 3-Carboxy-1-β-D-ribofuranosylpyridinium Inner Salt; 3-Carboxy-1-β-D-ribofuranosyl-?pyridinium Hydroxide Inner Salt; Nicotinic Acid Ribonucleoside; Nicotinic Riboside; |
Molecular Formula | C11H13NO6 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
InChI | InChI=1S/C11H13NO6/c13-5-7-8(14)9(15)10(18-7)12-3-1-2-6(4-12)11(16)17/h1-4,7-10,13-15H,5H2/t7-,8-,9-,10-/m1/s1 |
InChIKey | PUEDDPCUCPRQNY-ZYUZMQFOSA-N |
SMILES | C1=CC(=C[N+](=C1)C2C(C(C(O2)CO)O)O)C(=O)[O-] |