For research use only. Not for therapeutic Use.
Nicotinimidamide dihydrochloride(Cat No.:L006676), is a chemical compound of pharmaceutical significance. Its molecular structure involves nicotinamide, an amide derivative of niacin (vitamin B3), and two hydrochloride groups. This compound plays a role in various biological processes, making it valuable in research and drug development. Nicotinamide, a precursor to essential coenzymes like NAD and NADP, is vital for cellular metabolism. Compounds derived from nicotinamide, including this dihydrochloride salt, find applications in medicine, often used in studies related to enzyme activity, and metabolism, and as a potential therapeutic agent for certain medical conditions.
CAS Number | 63265-42-9 |
Molecular Formula | C6H9Cl2N3 |
Purity | ≥95% |
IUPAC Name | pyridine-3-carboximidamide;dihydrochloride |
InChI | InChI=1S/C6H7N3.2ClH/c7-6(8)5-2-1-3-9-4-5;;/h1-4H,(H3,7,8);2*1H |
InChIKey | VQCNPHBZGNFQBI-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)C(=N)N.Cl |