For research use only. Not for therapeutic Use.
Nicotinoyl-GABA（Cat No.:I012362）, is a compound derived from the combination of nicotinic acid (niacin) and gamma-aminobutyric acid (GABA). It is also known as Picamilon. This compound exhibits unique properties due to the combination of these two molecules. Nicotinoyl-GABA is often used as a nootropic supplement and is believed to have cognitive-enhancing effects. It is also reported to possess anxiolytic and vasodilatory properties. Nicotinoyl-GABA is commonly found in dietary supplements and is utilized for its potential benefits on brain function and mental well-being.
| Catalog Number | I012362 |
| CAS Number | 34562-97-5 |
| Synonyms | Pikamilon; Pikamilone; GABA-NG; 4-(Nicotinamido)butanoic acid; 4-[(Pyridin-3-ylcarbonyl)amino]butanoic acid |
| Molecular Formula | C10H12N2O3 |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | 4-(pyridine-3-carbonylamino)butanoic acid |
| InChI | InChI=1S/C10H12N2O3/c13-9(14)4-2-6-12-10(15)8-3-1-5-11-7-8/h1,3,5,7H,2,4,6H2,(H,12,15)(H,13,14) |
| InChIKey | NAJVRARAUNYNDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)NCCCC(=O)O |
