For research use only. Not for therapeutic Use.
NICOTINYL CHLORIDE HYDROCHLORIDE (Cat.No:M054974) is a chemical compound derived from niacin (vitamin B3). It finds applications in organic synthesis and pharmaceuticals. This derivative has unique reactivity due to its chloride salt form, making it valuable in the preparation of various compounds for research and industrial purposes.
Catalog Number | M054974 |
CAS Number | 10400-19-8 |
Molecular Formula | C6H4ClNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | pyridine-3-carbonyl chloride |
InChI | InChI=1S/C6H4ClNO/c7-6(9)5-2-1-3-8-4-5/h1-4H |
InChIKey | ATBIAJXSKNPHEI-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)C(=O)Cl |