For research use only. Not for therapeutic Use.
Nifuroxazide(Cat No.:A000699), is an antimicrobial agent used to treat various gastrointestinal infections. It belongs to the class of nitrofuran antibiotics. Nifuroxazide works by inhibiting the growth of bacteria and other microorganisms in the gut, making it effective in addressing conditions such as traveler’s diarrhea and acute gastroenteritis. Unlike some antibiotics, it typically does not get absorbed into the bloodstream, which minimizes systemic side effects.
CAS Number | 965-52-6 |
Synonyms | NA |
Molecular Formula | C12H9N3O5 |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Storage | 2-8°C |
IUPAC Name | 4-hydroxy-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
InChI | InChI=1S/C12H9N3O5/c16-9-3-1-8(2-4-9)12(17)14-13-7-10-5-6-11(20-10)15(18)19/h1-7,16H,(H,14,17)/b13-7+ |
InChIKey | YCWSUKQGVSGXJO-NTUHNPAUSA-N |
SMILES | C1=CC(=CC=C1C(=O)NN=CC2=CC=C(O2)[N+](=O)[O-])O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |