For research use only. Not for therapeutic Use.
Nifursemizone(Cat No.:I013599)is an antiparasitic drug primarily used for treating trypanosomiasis in animals, targeting protozoan parasites like Trypanosoma species. It belongs to the nitrofuran class, which acts by disrupting DNA and enzyme functions within the parasite, leading to cell death. Effective against various stages of trypanosome infection, nifursemizone is a valuable tool in managing diseases like sleeping sickness in animals. Its targeted action helps protect livestock health, minimizes disease transmission, and supports the productivity of animal populations in regions where trypanosomiasis is endemic.
CAS Number | 5579-89-5 |
Molecular Formula | C₈H₁₀N₄O₄ |
Purity | ≥95% |
Target | Parasite |
Solubility | DMSO |
Storage | Store at -20°C |
IUPAC Name | 1-ethyl-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea |
InChI | InChI=1S/C8H10N4O4/c1-2-11(8(9)13)10-5-6-3-4-7(16-6)12(14)15/h3-5H,2H2,1H3,(H2,9,13)/b10-5+ |
InChIKey | JGPNCLKRECLYTO-BJMVGYQFSA-N |
SMILES | CCN(C(=O)N)N=CC1=CC=C(O1)[N+](=O)[O-] |