For research use only. Not for therapeutic Use.
Nifursol-13C6(Cat No.:S000519) is an isotopically labeled version of nifursol, where six carbon atoms are replaced with carbon-13 (13C). Nifursol is a nitrofuran derivative historically used as a veterinary drug to prevent and treat histomoniasis, also known as blackhead disease, in poultry. The use of 13C labeling in nifursol enhances the ability to trace and study the drug’s metabolism and distribution within animal systems, which is crucial for understanding its pharmacokinetics and potential residues in food products.
Molecular Formula | C613C6H7N5O9 |
Purity | ≥95% |
IUPAC Name | 2-hydroxy-3,5-dinitro-N-[(E)-(5-nitrofuran-2-yl)methylideneamino](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxamide |
InChI | InChI=1S/C12H7N5O9/c18-11-8(3-6(15(20)21)4-9(11)16(22)23)12(19)14-13-5-7-1-2-10(26-7)17(24)25/h1-5,18H,(H,14,19)/b13-5+/i3+1,4+1,6+1,8+1,9+1,11+1 |
InChIKey | XXUXXCZCUGIGPP-AYIPRUOYSA-N |
SMILES | C1=C(OC(=C1)[N+](=O)[O-])C=NNC(=O)C2=C(C(=CC(=C2)[N+](=O)[O-])[N+](=O)[O-])O |