For research use only. Not for therapeutic Use.
Nifurtoinol(CAT: M069642) is a chemical compound that belongs to the class of nitrofuran derivatives. Its mode of action and pharmacological effects involve its interactions with bacterial enzymes and cellular processes due to its specific chemical structure. Nifurtoinol has been used as an antimicrobial agent, particularly for the treatment of urinary tract infections and other bacterial infections. It works by inhibiting bacterial protein synthesis and interfering with various metabolic pathways, ultimately leading to the death of bacterial pathogens. While its applications in human medicine have declined due to potential adverse effects, it has been used in veterinary medicine and other specialized applications.
CAS Number | 1088-92-2 |
Molecular Formula | C9H8N4O6 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 3-(hydroxymethyl)-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione |
InChI | InChI=1S/C9H8N4O6/c14-5-11-7(15)4-12(9(11)16)10-3-6-1-2-8(19-6)13(17)18/h1-3,14H,4-5H2/b10-3+ |
InChIKey | UIDWQGRXEVDFCA-XCVCLJGOSA-N |
SMILES | C1C(=O)N(C(=O)N1N=CC2=CC=C(O2)[N+](=O)[O-])CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |