For research use only. Not for therapeutic Use.
Nimodipine-d7(Cat No.:S000335) is a deuterated form of nimodipine, where seven hydrogen atoms are replaced with deuterium. Nimodipine is a calcium channel blocker that is specifically used to prevent and treat cerebral vasospasm, a condition commonly seen after a subarachnoid hemorrhage. The incorporation of deuterium into nimodipine enhances its molecular stability, allowing for more precise pharmacokinetic and metabolic analyses.
CAS Number | 1246815-36-0 |
Molecular Formula | C21H19D7N2O7 |
Purity | ≥95% |
Target | Membrane Transporter/Ion Channel |
IUPAC Name | 5-O-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl) 3-O-(2-methoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
InChI | InChI=1S/C21H26N2O7/c1-12(2)30-21(25)18-14(4)22-13(3)17(20(24)29-10-9-28-5)19(18)15-7-6-8-16(11-15)23(26)27/h6-8,11-12,19,22H,9-10H2,1-5H3/i1D3,2D3,12D |
InChIKey | UIAGMCDKSXEBJQ-QLWPOVNFSA-N |
SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCOC |