For research use only. Not for therapeutic Use.
Nimodipine(CAT: I004487) is a calcium channel blocker primarily used to prevent and treat cerebral vasospasm following a subarachnoid hemorrhage (SAH). By inhibiting calcium influx into vascular smooth muscle, it helps to relax and dilate blood vessels, improving cerebral blood flow and reducing the risk of ischemic damage. Nimodipine has also shown potential in treating neurological conditions like migraine and Alzheimer’s disease due to its neuroprotective effects. Its use is well-documented in managing conditions involving cerebrovascular dysfunction.
| Catalog Number | I004487 |
| CAS Number | 66085-59-4 |
| Synonyms | 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Formula | C21H26N2O7 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | DMSO 85 mg/mL; Water <1 mg/mL |
| Storage | store at -20 ℃ |
| IUPAC Name | 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChI | InChI=1S/C21H26N2O7/c1-12(2)30-21(25)18-14(4)22-13(3)17(20(24)29-10-9-28-5)19(18)15-7-6-8-16(11-15)23(26)27/h6-8,11-12,19,22H,9-10H2,1-5H3 |
| InChIKey | UIAGMCDKSXEBJQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCOC |
