For research use only. Not for therapeutic Use.
NITD-349（Cat No.:I020323）is an experimental antiviral compound primarily investigated for its potential to treat dengue virus infections. Developed through extensive research targeting viral replication mechanisms, NITD-349 works by inhibiting specific enzymes essential for viral RNA synthesis, thus preventing the virus from multiplying within host cells. Its activity against multiple dengue virus serotypes has shown promise in preclinical studies, highlighting its potential as a broad-spectrum antiviral. As dengue continues to be a global health concern, NITD-349 offers hope for an effective therapy, contributing to research efforts in antiviral drug development.
| Catalog Number | I020323 |
| CAS Number | 1473450-62-2 |
| Molecular Formula | C₁₇H₂₀F₂N₂O |
| Purity | ≥95% |
| Target | Bacterial |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide |
| InChI | InChI=1S/C17H20F2N2O/c1-17(2)5-3-11(4-6-17)20-16(22)15-9-12-13(19)7-10(18)8-14(12)21-15/h7-9,11,21H,3-6H2,1-2H3,(H,20,22) |
| InChIKey | UATYSFRIVIHVKL-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)NC(=O)C2=CC3=C(N2)C=C(C=C3F)F)C |
| Reference | [1]. Rao SP, et al. Indolcarboxamide is a preclinical candidate for treating multidrug-resistant tuberculosis. Sci Transl Med. 2013 Dec 4;5(214):214ra168. |
