For research use only. Not for therapeutic Use.
Nitrendipine is a calcium channel blocker widely used in cardiovascular research for its ability to lower blood pressure by relaxing vascular smooth muscles. This dihydropyridine derivative selectively inhibits L-type calcium channels, reducing calcium influx and promoting vasodilation. Its efficacy in managing hypertension and its potential in investigating calcium-dependent pathways make it valuable in pharmacological studies. With high selectivity and potency, nitrendipine serves as a critical tool in understanding vascular physiology and developing novel therapeutic strategies for cardiovascular diseases.
| Catalog Number | A000325 |
| CAS Number | 39562-70-4 |
| Synonyms | 39562-70-4; Bayotensin; Baypress; Nidrel; Nitrendipinum |
| Molecular Formula | C18H20N2O6 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | >13.7mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChI | 1S/C18H20N2O6/c1-5-26-18(22)15-11(3)19-10(2)14(17(21)25-4)16(15)12-7-6-8-13(9-12)20(23)24/h6-9,16,19H,5H2,1-4H3 |
| InChIKey | PVHUJELLJLJGLN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC)C)C |
